| Name | Disperse Orange 30 |
| Synonyms | Disperse Orange 30 Disperse Orange 30 Disperse Yellow Brown 2RFL 2-[2-cyanoethyl-[4-(2,6-dichloro-4-nitro-phenyl)azophenyl]amino]ethyl acetate 2-[(2-cyanoethyl){4-[(E)-(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl}amino]ethyl acetate |
| CAS | 12223-23-3 |
| EINECS | 226-070-4 |
| InChI | InChI=1/C19H17Cl2N5O4/c1-13(27)30-10-9-25(8-2-7-22)15-5-3-14(4-6-15)23-24-19-17(20)11-16(26(28)29)12-18(19)21/h3-6,11-12H,2,8-10H2,1H3 |
| Molecular Formula | C19H17Cl2N5O4 |
| Molar Mass | 450.275 |
| Density | 1.38g/cm3 |
| Boling Point | 645°C at 760 mmHg |
| Flash Point | 343.9°C |
| Vapor Presure | 1.59E-16mmHg at 25°C |
| Refractive Index | 1.618 |
| Use | Uses can be used for dyeing polyester, blended and vinegar fabrics, and can also be used for direct printing of pure polyester and polyester/cotton. |
| Downstream Products | Disperse Black S-3BL |
| EPA chemical information | Propanenitrile, 3-[[2-(acetyloxy)ethyl][4-[( 2,6-dichloro-4-nitrophenyl) azo]phenyl]amino]-(12223-23-3) |